C14H22ClIN4 — CID 110911931
4-(4-chlorophenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110911931) has the molecular formula C14H22ClIN4 and a molecular weight of 408.72 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110911931 |
| Molecular Formula | C14H22ClIN4 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-propylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCC/N=C(\N)N1CCN(c2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C14H21ClN4.HI/c1-2-7-17-14(16)19-10-8-18(9-11-19)13-5-3-12(15)4-6-13;/h3-6H,2,7-11H2,1H3,(H2,16,17);1H |
| InChIKey | UYGDGIHDKSIXKI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|