C3H10N6 — CID 123981435
2-(aminomethyl)-1-(diaminomethylidene)guanidine (PubChem CID 123981435) has the molecular formula C3H10N6 and a molecular weight of 130.16 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(aminomethyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 123981435 |
| Molecular Formula | C3H10N6 |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-(aminomethyl)-1-(diaminomethylidene)guanidine |
| SMILES | NCN=C(N)N=C(N)N |
| InChI | InChI=1S/C3H10N6/c4-1-8-3(7)9-2(5)6/h1,4H2,(H6,5,6,7,8,9) |
| InChIKey | JOIBCSLSXSWLJX-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|