C5H17N6O4P — CID 174852963
2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;phosphoric acid (PubChem CID 174852963) has the molecular formula C5H17N6O4P and a molecular weight of 256.20 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;phosphoric acid.
| Compound Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;phosphoric acid |
|---|---|
| PubChem CID | 174852963 |
| Molecular Formula | C5H17N6O4P |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;phosphoric acid |
| SMILES | NCCC/N=C(\N)N=C(N)N.O=P(O)(O)O |
| InChI | InChI=1S/C5H14N6.H3O4P/c6-2-1-3-10-5(9)11-4(7)8;1-5(2,3)4/h1-3,6H2,(H6,7,8,9,10,11);(H3,1,2,3,4) |
| InChIKey | MLCVFSBQSQIHGN-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|