C5H17BN6O3 — CID 87314580
2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;boric acid (PubChem CID 87314580) has the molecular formula C5H17BN6O3 and a molecular weight of 220.04 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;boric acid.
| Compound Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;boric acid |
|---|---|
| PubChem CID | 87314580 |
| Molecular Formula | C5H17BN6O3 |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-(3-aminopropyl)-1-(diaminomethylidene)guanidine;boric acid |
| SMILES | NCCC/N=C(\N)N=C(N)N.OB(O)O |
| InChI | InChI=1S/C5H14N6.BH3O3/c6-2-1-3-10-5(9)11-4(7)8;2-1(3)4/h1-3,6H2,(H6,7,8,9,10,11);2-4H |
| InChIKey | SVLKCZJGQKNKKB-UHFFFAOYSA-N |
| XLogP | -4.13 |
| TPSA | 189.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|