C9H22N10 — CID 22639468
2-[5-[[amino-(diaminomethylideneamino)methylidene]amino]pentyl]-1-(diaminomethylidene)guanidine (PubChem CID 22639468) has the molecular formula C9H22N10 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-[5-[[amino-(diaminomethylideneamino)methylidene]amino]pentyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[5-[[amino-(diaminomethylideneamino)methylidene]amino]pentyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 22639468 |
| Molecular Formula | C9H22N10 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 2-[5-[[amino-(diaminomethylideneamino)methylidene]amino]pentyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/CCCCC/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C9H22N10/c10-6(11)18-8(14)16-4-2-1-3-5-17-9(15)19-7(12)13/h1-5H2,(H6,10,11,14,16,18)(H6,12,13,15,17,19) |
| InChIKey | GEPXLDLVTRMBJJ-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 205.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|