C22H32Cl4N10 — CID 20843964
2-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-1,3-bis(4-chlorophenyl)guanidine;dihydrochloride (PubChem CID 20843964) has the molecular formula C22H32Cl4N10 and a molecular weight of 578.38 g/mol. Its IUPAC name is 2-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-1,3-bis(4-chlorophenyl)guanidine;dihydrochloride.
| Compound Name | 2-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-1,3-bis(4-chlorophenyl)guanidine;dihydrochloride |
|---|---|
| PubChem CID | 20843964 |
| Molecular Formula | C22H32Cl4N10 |
| Molecular Weight | 578.38 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-1,3-bis(4-chlorophenyl)guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=N/C(N)=N/CCCCCC/N=C(\N)N=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30Cl2N10.2ClH/c23-15-5-9-17(10-6-15)31-22(32-18-11-7-16(24)8-12-18)34-21(28)30-14-4-2-1-3-13-29-20(27)33-19(25)26;;/h5-12H,1-4,13-14H2,(H6,25,26,27,29,33)(H4,28,30,31,32,34);2*1H |
| InChIKey | LDHAGSOGKHFAPH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|