C18H22Cl2N10 — CID 70500438
2-[2-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]ethyl]-1-[amino-(4-chloroanilino)methylidene]guanidine (PubChem CID 70500438) has the molecular formula C18H22Cl2N10 and a molecular weight of 449.35 g/mol. Its IUPAC name is 2-[2-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]ethyl]-1-[amino-(4-chloroanilino)methylidene]guanidine.
| Compound Name | 2-[2-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]ethyl]-1-[amino-(4-chloroanilino)methylidene]guanidine |
|---|---|
| PubChem CID | 70500438 |
| Molecular Formula | C18H22Cl2N10 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[2-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]ethyl]-1-[amino-(4-chloroanilino)methylidene]guanidine |
| SMILES | NC(=N/C(N)=N/CC/N=C(\N)N=C(N)Nc1ccc(Cl)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22Cl2N10/c19-11-1-5-13(6-2-11)27-17(23)29-15(21)25-9-10-26-16(22)30-18(24)28-14-7-3-12(20)4-8-14/h1-8H,9-10H2,(H5,21,23,25,27,29)(H5,22,24,26,28,30) |
| InChIKey | GXTQUXMMSCEADM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|