C30H41BrN5P — CID 138567266
2-[10-[bromo(triphenyl)-λ5-phosphanyl]decyl]-1-(diaminomethylidene)guanidine (PubChem CID 138567266) has the molecular formula C30H41BrN5P and a molecular weight of 582.57 g/mol. Its IUPAC name is 2-[10-[bromo(triphenyl)-λ5-phosphanyl]decyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[10-[bromo(triphenyl)-λ5-phosphanyl]decyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 138567266 |
| Molecular Formula | C30H41BrN5P |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 2-[10-[bromo(triphenyl)-λ5-phosphanyl]decyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/CCCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H41BrN5P/c31-37(26-18-10-7-11-19-26,27-20-12-8-13-21-27,28-22-14-9-15-23-28)25-17-6-4-2-1-3-5-16-24-35-30(34)36-29(32)33/h7-15,18-23H,1-6,16-17,24-25H2,(H6,32,33,34,35,36) |
| InChIKey | AITSVOSSVIEPIP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|