C19H35Cl2N5 — CID 86657179
1-benzyl-1-methyl-2-(N'-nonylcarbamimidoyl)guanidine;dihydrochloride (PubChem CID 86657179) has the molecular formula C19H35Cl2N5 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-benzyl-1-methyl-2-(N'-nonylcarbamimidoyl)guanidine;dihydrochloride.
| Compound Name | 1-benzyl-1-methyl-2-(N'-nonylcarbamimidoyl)guanidine;dihydrochloride |
|---|---|
| PubChem CID | 86657179 |
| Molecular Formula | C19H35Cl2N5 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-benzyl-1-methyl-2-(N'-nonylcarbamimidoyl)guanidine;dihydrochloride |
| SMILES | CCCCCCCCC/N=C(\N)N=C(N)N(C)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H33N5.2ClH/c1-3-4-5-6-7-8-12-15-22-18(20)23-19(21)24(2)16-17-13-10-9-11-14-17;;/h9-11,13-14H,3-8,12,15-16H2,1-2H3,(H4,20,21,22,23);2*1H |
| InChIKey | JHANBVPVWYXJMY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|