C19H32N2 — CID 525622
N'-decyl-N,N-dimethylbenzenecarboximidamide (PubChem CID 525622) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is N'-decyl-N,N-dimethylbenzenecarboximidamide.
| Compound Name | N'-decyl-N,N-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 525622 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N'-decyl-N,N-dimethylbenzenecarboximidamide |
| SMILES | CCCCCCCCCC/N=C(/c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H32N2/c1-4-5-6-7-8-9-10-14-17-20-19(21(2)3)18-15-12-11-13-16-18/h11-13,15-16H,4-10,14,17H2,1-3H3/b20-19- |
| InChIKey | GWMPNBFTDPWXCX-VXPUYCOJSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|