C19H31NSe — CID 11792306
N,N-dihexylbenzenecarboselenoamide (PubChem CID 11792306) has the molecular formula C19H31NSe and a molecular weight of 352.42 g/mol. Its IUPAC name is N,N-dihexylbenzenecarboselenoamide.
| Compound Name | N,N-dihexylbenzenecarboselenoamide |
|---|---|
| PubChem CID | 11792306 |
| Molecular Formula | C19H31NSe |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N,N-dihexylbenzenecarboselenoamide |
| SMILES | CCCCCCN(CCCCCC)C(=[Se])c1ccccc1 |
| InChI | InChI=1S/C19H31NSe/c1-3-5-7-12-16-20(17-13-8-6-4-2)19(21)18-14-10-9-11-15-18/h9-11,14-15H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | JYKBTKDPIARLGA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|