C25H36N2S — CID 20549673
1,1-dihexyl-3,3-diphenylthiourea (PubChem CID 20549673) has the molecular formula C25H36N2S and a molecular weight of 396.64 g/mol. Its IUPAC name is 1,1-dihexyl-3,3-diphenylthiourea.
| Compound Name | 1,1-dihexyl-3,3-diphenylthiourea |
|---|---|
| PubChem CID | 20549673 |
| Molecular Formula | C25H36N2S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1,1-dihexyl-3,3-diphenylthiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N2S/c1-3-5-7-15-21-26(22-16-8-6-4-2)25(28)27(23-17-11-9-12-18-23)24-19-13-10-14-20-24/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3 |
| InChIKey | NHLXBNVKDHQZCB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|