About 1,1-dihexyl-3,3-diphenylthiourea
1,1-dihexyl-3,3-diphenylthiourea (PubChem CID 20549673) has the molecular formula C25H36N2S
and a molecular weight of 396.64 g/mol. Its IUPAC name is 1,1-dihexyl-3,3-diphenylthiourea.
Molecular Properties
| Compound Name | 1,1-dihexyl-3,3-diphenylthiourea |
| PubChem CID | 20549673 |
| Molecular Formula | C25H36N2S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1,1-dihexyl-3,3-diphenylthiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N2S/c1-3-5-7-15-21-26(22-16-8-6-4-2)25(28)27(23-17-11-9-12-18-23)24-19-13-10-14-20-24/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3 |
| InChIKey | NHLXBNVKDHQZCB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dihexyl-3,3-diphenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dihexyl-3,3-diphenylthiourea?
The IUPAC name of 1,1-dihexyl-3,3-diphenylthiourea (CID 20549673) is 1,1-dihexyl-3,3-diphenylthiourea.
What is the SMILES notation for 1,1-dihexyl-3,3-diphenylthiourea?
The canonical SMILES for 1,1-dihexyl-3,3-diphenylthiourea is CCCCCCN(CCCCCC)C(=S)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,1-dihexyl-3,3-diphenylthiourea?
The InChIKey is NHLXBNVKDHQZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36N2S/c1-3-5-7-15-21-26(22-16-8-6-4-2)25(28)27(23-17-11-9-12-18-23)24-19-13-10-14-20-24/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3.
What are the key properties of 1,1-dihexyl-3,3-diphenylthiourea?
1,1-dihexyl-3,3-diphenylthiourea has a molecular weight of 396.64 g/mol, XLogP of 7.57, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dihexyl-3,3-diphenylthiourea is sourced from PubChem (CID 20549673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).