C15H23NS — CID 12716080
N,N-dibutylbenzenecarbothioamide (PubChem CID 12716080) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is N,N-dibutylbenzenecarbothioamide.
| Compound Name | N,N-dibutylbenzenecarbothioamide |
|---|---|
| PubChem CID | 12716080 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N,N-dibutylbenzenecarbothioamide |
| SMILES | CCCCN(CCCC)C(=S)c1ccccc1 |
| InChI | InChI=1S/C15H23NS/c1-3-5-12-16(13-6-4-2)15(17)14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | UEMKKEFOIYSJNA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|