C32H50N2S4Sn — CID 10794904
[dibenzyl(dibutylcarbamothioylsulfanyl)stannyl] N,N-dibutylcarbamodithioate (PubChem CID 10794904) has the molecular formula C32H50N2S4Sn and a molecular weight of 709.75 g/mol. Its IUPAC name is [dibenzyl(dibutylcarbamothioylsulfanyl)stannyl] N,N-dibutylcarbamodithioate.
| Compound Name | [dibenzyl(dibutylcarbamothioylsulfanyl)stannyl] N,N-dibutylcarbamodithioate |
|---|---|
| PubChem CID | 10794904 |
| Molecular Formula | C32H50N2S4Sn |
| Molecular Weight | 709.75 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | [dibenzyl(dibutylcarbamothioylsulfanyl)stannyl] N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)S[Sn](Cc1ccccc1)(Cc1ccccc1)SC(=S)N(CCCC)CCCC |
| InChI | InChI=1S/2C9H19NS2.2C7H7.Sn/c2*1-3-5-7-10(9(11)12)8-6-4-2;2*1-7-5-3-2-4-6-7;/h2*3-8H2,1-2H3,(H,11,12);2*2-6H,1H2;/q;;;;+2/p-2 |
| InChIKey | NFMQDULRRGVKOU-UHFFFAOYSA-L |
| XLogP | 9.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.75 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|