C15H24N2O2S3 — CID 88798592
benzenesulfonamido N,N-dibutylcarbamodithioate (PubChem CID 88798592) has the molecular formula C15H24N2O2S3 and a molecular weight of 360.57 g/mol. Its IUPAC name is benzenesulfonamido N,N-dibutylcarbamodithioate.
| Compound Name | benzenesulfonamido N,N-dibutylcarbamodithioate |
|---|---|
| PubChem CID | 88798592 |
| Molecular Formula | C15H24N2O2S3 |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | benzenesulfonamido N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O2S3/c1-3-5-12-17(13-6-4-2)15(20)21-16-22(18,19)14-10-8-7-9-11-14/h7-11,16H,3-6,12-13H2,1-2H3 |
| InChIKey | GSSYQSAMMIVDSC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|