About 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea
3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea (PubChem CID 134920292) has the molecular formula C16H25N3O2S2
and a molecular weight of 355.53 g/mol. Its IUPAC name is 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea.
Molecular Properties
| Compound Name | 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea |
| PubChem CID | 134920292 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea |
| SMILES | CCCCN(CCCC)C(=S)N/C=N\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H25N3O2S2/c1-3-5-12-19(13-6-4-2)16(22)17-14-18-23(20,21)15-10-8-7-9-11-15/h7-11,14H,3-6,12-13H2,1-2H3,(H,17,18,22) |
| InChIKey | HZVJPNASKYBURT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea?
The IUPAC name of 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea (CID 134920292) is 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea.
What is the SMILES notation for 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea?
The canonical SMILES for 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea is CCCCN(CCCC)C(=S)N/C=N\S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea?
The InChIKey is HZVJPNASKYBURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2S2/c1-3-5-12-19(13-6-4-2)16(22)17-14-18-23(20,21)15-10-8-7-9-11-15/h7-11,14H,3-6,12-13H2,1-2H3,(H,17,18,22).
What are the key properties of 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea?
3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea has a molecular weight of 355.53 g/mol, XLogP of 3.18, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-benzenesulfonyliminomethyl]-1,1-dibutylthiourea is sourced from PubChem (CID 134920292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).