C23H35N5O2S2 — CID 19653425
1,1-dihexyl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 19653425) has the molecular formula C23H35N5O2S2 and a molecular weight of 477.70 g/mol. Its IUPAC name is 1,1-dihexyl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1,1-dihexyl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19653425 |
| Molecular Formula | C23H35N5O2S2 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1,1-dihexyl-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C23H35N5O2S2/c1-3-5-7-9-18-28(19-10-8-6-4-2)23(31)26-20-12-14-21(15-13-20)32(29,30)27-22-24-16-11-17-25-22/h11-17H,3-10,18-19H2,1-2H3,(H,26,31)(H,24,25,27) |
| InChIKey | LNURVJSEPAQIBJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|