C28H56N4S8 — CID 90091780
dibutylcarbamothioylsulfanyl N,N-dibutylcarbamodithioate;diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate (PubChem CID 90091780) has the molecular formula C28H56N4S8 and a molecular weight of 705.32 g/mol. Its IUPAC name is dibutylcarbamothioylsulfanyl N,N-dibutylcarbamodithioate;diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate.
| Compound Name | dibutylcarbamothioylsulfanyl N,N-dibutylcarbamodithioate;diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 90091780 |
| Molecular Formula | C28H56N4S8 |
| Molecular Weight | 705.32 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | dibutylcarbamothioylsulfanyl N,N-dibutylcarbamodithioate;diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SSC(=S)N(CCCC)CCCC.CCN(CC)C(=S)SSC(=S)N(CC)CC |
| InChI | InChI=1S/C18H36N2S4.C10H20N2S4/c1-5-9-13-19(14-10-6-2)17(21)23-24-18(22)20(15-11-7-3)16-12-8-4;1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-16H2,1-4H3;5-8H2,1-4H3 |
| InChIKey | AYNMRMSZLAGHEC-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.32 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|