C11H23NS — CID 45118577
N,N-dibutylpropanethioamide (PubChem CID 45118577) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is N,N-dibutylpropanethioamide.
| Compound Name | N,N-dibutylpropanethioamide |
|---|---|
| PubChem CID | 45118577 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N,N-dibutylpropanethioamide |
| SMILES | CCCCN(CCCC)C(=S)CC |
| InChI | InChI=1S/C11H23NS/c1-4-7-9-12(10-8-5-2)11(13)6-3/h4-10H2,1-3H3 |
| InChIKey | REZDWYXKGHYCQW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|