C9H22ClN3S — CID 131954492
3-amino-1,1-dibutylthiourea;hydrochloride (PubChem CID 131954492) has the molecular formula C9H22ClN3S and a molecular weight of 239.82 g/mol. Its IUPAC name is 3-amino-1,1-dibutylthiourea;hydrochloride.
| Compound Name | 3-amino-1,1-dibutylthiourea;hydrochloride |
|---|---|
| PubChem CID | 131954492 |
| Molecular Formula | C9H22ClN3S |
| Molecular Weight | 239.82 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-amino-1,1-dibutylthiourea;hydrochloride |
| SMILES | CCCCN(CCCC)C(=S)NN.Cl |
| InChI | InChI=1S/C9H21N3S.ClH/c1-3-5-7-12(8-6-4-2)9(13)11-10;/h3-8,10H2,1-2H3,(H,11,13);1H |
| InChIKey | DHOKEGWISNXRTD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|