C9H20N2SZn — CID 175070562
1,1-dibutylthiourea;zinc (PubChem CID 175070562) has the molecular formula C9H20N2SZn and a molecular weight of 253.73 g/mol. Its IUPAC name is 1,1-dibutylthiourea;zinc.
| Compound Name | 1,1-dibutylthiourea;zinc |
|---|---|
| PubChem CID | 175070562 |
| Molecular Formula | C9H20N2SZn |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1,1-dibutylthiourea;zinc |
| SMILES | CCCCN(CCCC)C(N)=S.[Zn] |
| InChI | InChI=1S/C9H20N2S.Zn/c1-3-5-7-11(9(10)12)8-6-4-2;/h3-8H2,1-2H3,(H2,10,12); |
| InChIKey | WYYCIESUDUIUON-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|