C22H44N2O2S2 — CID 615476
N,N-dibutyl-2-[2-[2-(dibutylamino)-2-sulfanylideneethoxy]ethoxy]ethanethioamide (PubChem CID 615476) has the molecular formula C22H44N2O2S2 and a molecular weight of 432.74 g/mol. Its IUPAC name is N,N-dibutyl-2-[2-[2-(dibutylamino)-2-sulfanylideneethoxy]ethoxy]ethanethioamide.
| Compound Name | N,N-dibutyl-2-[2-[2-(dibutylamino)-2-sulfanylideneethoxy]ethoxy]ethanethioamide |
|---|---|
| PubChem CID | 615476 |
| Molecular Formula | C22H44N2O2S2 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N,N-dibutyl-2-[2-[2-(dibutylamino)-2-sulfanylideneethoxy]ethoxy]ethanethioamide |
| SMILES | CCCCN(CCCC)C(=S)COCCOCC(=S)N(CCCC)CCCC |
| InChI | InChI=1S/C22H44N2O2S2/c1-5-9-13-23(14-10-6-2)21(27)19-25-17-18-26-20-22(28)24(15-11-7-3)16-12-8-4/h5-20H2,1-4H3 |
| InChIKey | NKWPVGBRWCCVGT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|