C40H64N2O5S2 — CID 100974997
2-[2-[2-[2-[2-[2-(dipentylamino)-2-sulfanylideneethoxy]phenoxy]ethoxy]ethoxy]phenoxy]-N,N-dipentylethanethioamide (PubChem CID 100974997) has the molecular formula C40H64N2O5S2 and a molecular weight of 717.10 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(dipentylamino)-2-sulfanylideneethoxy]phenoxy]ethoxy]ethoxy]phenoxy]-N,N-dipentylethanethioamide.
| Compound Name | 2-[2-[2-[2-[2-[2-(dipentylamino)-2-sulfanylideneethoxy]phenoxy]ethoxy]ethoxy]phenoxy]-N,N-dipentylethanethioamide |
|---|---|
| PubChem CID | 100974997 |
| Molecular Formula | C40H64N2O5S2 |
| Molecular Weight | 717.10 g/mol |
| Exact Mass | 716.43 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(dipentylamino)-2-sulfanylideneethoxy]phenoxy]ethoxy]ethoxy]phenoxy]-N,N-dipentylethanethioamide |
| SMILES | CCCCCN(CCCCC)C(=S)COc1ccccc1OCCOCCOc1ccccc1OCC(=S)N(CCCCC)CCCCC |
| InChI | InChI=1S/C40H64N2O5S2/c1-5-9-17-25-41(26-18-10-6-2)39(48)33-46-37-23-15-13-21-35(37)44-31-29-43-30-32-45-36-22-14-16-24-38(36)47-34-40(49)42(27-19-11-7-3)28-20-12-8-4/h13-16,21-24H,5-12,17-20,25-34H2,1-4H3 |
| InChIKey | GVVQJFBQJXGXGO-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.10 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|