About 2-butoxyethanethioamide
2-butoxyethanethioamide (PubChem CID 43267695) has the molecular formula C6H13NOS
and a molecular weight of 147.24 g/mol. Its IUPAC name is 2-butoxyethanethioamide.
Molecular Properties
| Compound Name | 2-butoxyethanethioamide |
| PubChem CID | 43267695 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-butoxyethanethioamide |
| SMILES | CCCCOCC(N)=S |
| InChI | InChI=1S/C6H13NOS/c1-2-3-4-8-5-6(7)9/h2-5H2,1H3,(H2,7,9) |
| InChIKey | LSWJUMGQDJIAIC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethanethioamide?
The IUPAC name of 2-butoxyethanethioamide (CID 43267695) is 2-butoxyethanethioamide.
What is the SMILES notation for 2-butoxyethanethioamide?
The canonical SMILES for 2-butoxyethanethioamide is CCCCOCC(N)=S.
What is the InChIKey of 2-butoxyethanethioamide?
The InChIKey is LSWJUMGQDJIAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS/c1-2-3-4-8-5-6(7)9/h2-5H2,1H3,(H2,7,9).
What are the key properties of 2-butoxyethanethioamide?
2-butoxyethanethioamide has a molecular weight of 147.24 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethanethioamide is sourced from PubChem (CID 43267695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).