About 3-hexoxypropanethioamide
3-hexoxypropanethioamide (PubChem CID 29002450) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is 3-hexoxypropanethioamide.
Molecular Properties
| Compound Name | 3-hexoxypropanethioamide |
| PubChem CID | 29002450 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-hexoxypropanethioamide |
| SMILES | CCCCCCOCCC(N)=S |
| InChI | InChI=1S/C9H19NOS/c1-2-3-4-5-7-11-8-6-9(10)12/h2-8H2,1H3,(H2,10,12) |
| InChIKey | PWLRDMJXGWDXMB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxypropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxypropanethioamide?
The IUPAC name of 3-hexoxypropanethioamide (CID 29002450) is 3-hexoxypropanethioamide.
What is the SMILES notation for 3-hexoxypropanethioamide?
The canonical SMILES for 3-hexoxypropanethioamide is CCCCCCOCCC(N)=S.
What is the InChIKey of 3-hexoxypropanethioamide?
The InChIKey is PWLRDMJXGWDXMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-2-3-4-5-7-11-8-6-9(10)12/h2-8H2,1H3,(H2,10,12).
What are the key properties of 3-hexoxypropanethioamide?
3-hexoxypropanethioamide has a molecular weight of 189.32 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxypropanethioamide is sourced from PubChem (CID 29002450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).