C16H26N4S2 — CID 21464810
1,1-dibutylthiourea;1,3-dihydrobenzimidazole-2-thione (PubChem CID 21464810) has the molecular formula C16H26N4S2 and a molecular weight of 338.55 g/mol. Its IUPAC name is 1,1-dibutylthiourea;1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 1,1-dibutylthiourea;1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 21464810 |
| Molecular Formula | C16H26N4S2 |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1,1-dibutylthiourea;1,3-dihydrobenzimidazole-2-thione |
| SMILES | CCCCN(CCCC)C(N)=S.S=c1[nH]c2ccccc2[nH]1 |
| InChI | InChI=1S/C9H20N2S.C7H6N2S/c1-3-5-7-11(9(10)12)8-6-4-2;10-7-8-5-3-1-2-4-6(5)9-7/h3-8H2,1-2H3,(H2,10,12);1-4H,(H2,8,9,10) |
| InChIKey | LPFJBIJJNSYSJV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|