C18H28N2OS — CID 161130418
N-carbamothioyl-N-decylbenzamide (PubChem CID 161130418) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is N-carbamothioyl-N-decylbenzamide.
| Compound Name | N-carbamothioyl-N-decylbenzamide |
|---|---|
| PubChem CID | 161130418 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-carbamothioyl-N-decylbenzamide |
| SMILES | CCCCCCCCCCN(C(=O)c1ccccc1)C(N)=S |
| InChI | InChI=1S/C18H28N2OS/c1-2-3-4-5-6-7-8-12-15-20(18(19)22)17(21)16-13-10-9-11-14-16/h9-11,13-14H,2-8,12,15H2,1H3,(H2,19,22) |
| InChIKey | UMCIQWOXRMKXOM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|