C23H31NO2 — CID 69013221
1,2-diphenylethane-1,2-dione;N-ethyl-N-methylhexan-1-amine (PubChem CID 69013221) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;N-ethyl-N-methylhexan-1-amine.
| Compound Name | 1,2-diphenylethane-1,2-dione;N-ethyl-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 69013221 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;N-ethyl-N-methylhexan-1-amine |
| SMILES | CCCCCCN(C)CC.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C9H21N/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-4-6-7-8-9-10(3)5-2/h1-10H;4-9H2,1-3H3 |
| InChIKey | RZGZRWRJJLPMLO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|