C22H29NO2 — CID 69012000
N,N-dimethylhexan-1-amine;1,2-diphenylethane-1,2-dione (PubChem CID 69012000) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N,N-dimethylhexan-1-amine;1,2-diphenylethane-1,2-dione.
| Compound Name | N,N-dimethylhexan-1-amine;1,2-diphenylethane-1,2-dione |
|---|---|
| PubChem CID | 69012000 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N,N-dimethylhexan-1-amine;1,2-diphenylethane-1,2-dione |
| SMILES | CCCCCCN(C)C.O=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2.C8H19N/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-4-5-6-7-8-9(2)3/h1-10H;4-8H2,1-3H3 |
| InChIKey | KLVNKPDEEXGRGO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|