C21H34NO3- — CID 163981787
N,N-dimethyldecan-1-amine;2-oxo-3-phenylpropanoate (PubChem CID 163981787) has the molecular formula C21H34NO3- and a molecular weight of 348.51 g/mol. Its IUPAC name is N,N-dimethyldecan-1-amine;2-oxo-3-phenylpropanoate.
| Compound Name | N,N-dimethyldecan-1-amine;2-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 163981787 |
| Molecular Formula | C21H34NO3- |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N,N-dimethyldecan-1-amine;2-oxo-3-phenylpropanoate |
| SMILES | CCCCCCCCCCN(C)C.O=C([O-])C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H27N.C9H8O3/c1-4-5-6-7-8-9-10-11-12-13(2)3;10-8(9(11)12)6-7-4-2-1-3-5-7/h4-12H2,1-3H3;1-5H,6H2,(H,11,12)/p-1 |
| InChIKey | SZAPJQAJIBAJFX-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|