About pentyl 2-oxo-3-phenylpropanoate
pentyl 2-oxo-3-phenylpropanoate (PubChem CID 22404239) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is pentyl 2-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | pentyl 2-oxo-3-phenylpropanoate |
| PubChem CID | 22404239 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | pentyl 2-oxo-3-phenylpropanoate |
| SMILES | CCCCCOC(=O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-2-3-7-10-17-14(16)13(15)11-12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3 |
| InChIKey | UXPRNDYRJZSKMM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze pentyl 2-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 2-oxo-3-phenylpropanoate?
The IUPAC name of pentyl 2-oxo-3-phenylpropanoate (CID 22404239) is pentyl 2-oxo-3-phenylpropanoate.
What is the SMILES notation for pentyl 2-oxo-3-phenylpropanoate?
The canonical SMILES for pentyl 2-oxo-3-phenylpropanoate is CCCCCOC(=O)C(=O)Cc1ccccc1.
What is the InChIKey of pentyl 2-oxo-3-phenylpropanoate?
The InChIKey is UXPRNDYRJZSKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-2-3-7-10-17-14(16)13(15)11-12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3.
What are the key properties of pentyl 2-oxo-3-phenylpropanoate?
pentyl 2-oxo-3-phenylpropanoate has a molecular weight of 234.30 g/mol, XLogP of 2.53, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 2-oxo-3-phenylpropanoate is sourced from PubChem (CID 22404239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).