C24H37NO2 — CID 54397990
octyl (2Z,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate (PubChem CID 54397990) has the molecular formula C24H37NO2 and a molecular weight of 371.56 g/mol. Its IUPAC name is octyl (2Z,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | octyl (2Z,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 54397990 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | octyl (2Z,4E)-2-benzyl-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CCCCCCCCOC(=O)/C(=C\C=C\N(CC)CC)Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO2/c1-4-7-8-9-10-14-20-27-24(26)23(18-15-19-25(5-2)6-3)21-22-16-12-11-13-17-22/h11-13,15-19H,4-10,14,20-21H2,1-3H3/b19-15+,23-18- |
| InChIKey | VLJMQYDHDHBUEJ-FDEBRDSSSA-N |
| XLogP | 5.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|