C22H28F3NO3 — CID 143968126
octyl (2Z,4E)-5-(N-acetylanilino)-2-(trifluoromethyl)penta-2,4-dienoate (PubChem CID 143968126) has the molecular formula C22H28F3NO3 and a molecular weight of 411.46 g/mol. Its IUPAC name is octyl (2Z,4E)-5-(N-acetylanilino)-2-(trifluoromethyl)penta-2,4-dienoate.
| Compound Name | octyl (2Z,4E)-5-(N-acetylanilino)-2-(trifluoromethyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 143968126 |
| Molecular Formula | C22H28F3NO3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | octyl (2Z,4E)-5-(N-acetylanilino)-2-(trifluoromethyl)penta-2,4-dienoate |
| SMILES | CCCCCCCCOC(=O)/C(=C/C=C/N(C(C)=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H28F3NO3/c1-3-4-5-6-7-11-17-29-21(28)20(22(23,24)25)15-12-16-26(18(2)27)19-13-9-8-10-14-19/h8-10,12-16H,3-7,11,17H2,1-2H3/b16-12+,20-15- |
| InChIKey | TZIRPPMYUXOKJR-PNGQTJDWSA-N |
| XLogP | 5.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|