C23H35NO4S — CID 59996529
octyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate (PubChem CID 59996529) has the molecular formula C23H35NO4S and a molecular weight of 421.60 g/mol. Its IUPAC name is octyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | octyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 59996529 |
| Molecular Formula | C23H35NO4S |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | octyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CCCCCCCCOC(=O)C(=CC=CN(CC)CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H35NO4S/c1-4-7-8-9-10-14-20-28-23(25)22(18-15-19-24(5-2)6-3)29(26,27)21-16-12-11-13-17-21/h11-13,15-19H,4-10,14,20H2,1-3H3 |
| InChIKey | LBNUXTQQOXBRAR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|