C17H23NO5S — CID 54395439
ethyl 2-(benzenesulfonyl)-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate (PubChem CID 54395439) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate.
| Compound Name | ethyl 2-(benzenesulfonyl)-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate |
|---|---|
| PubChem CID | 54395439 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-5-[ethyl(2-hydroxyethyl)amino]penta-2,4-dienoate |
| SMILES | CCOC(=O)C(=CC=CN(CC)CCO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO5S/c1-3-18(13-14-19)12-8-11-16(17(20)23-4-2)24(21,22)15-9-6-5-7-10-15/h5-12,19H,3-4,13-14H2,1-2H3 |
| InChIKey | VJPIJGZUXSBXDD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|