C19H25IO4S — CID 88945362
2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-iodopenta-2,4-dienoate (PubChem CID 88945362) has the molecular formula C19H25IO4S and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-iodopenta-2,4-dienoate.
| Compound Name | 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-iodopenta-2,4-dienoate |
|---|---|
| PubChem CID | 88945362 |
| Molecular Formula | C19H25IO4S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-iodopenta-2,4-dienoate |
| SMILES | CCCCC(CC)COC(=O)/C(=C\C=C\I)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25IO4S/c1-3-5-10-16(4-2)15-24-19(21)18(13-9-14-20)25(22,23)17-11-7-6-8-12-17/h6-9,11-14,16H,3-5,10,15H2,1-2H3/b14-9+,18-13+ |
| InChIKey | NWXUGPYRMKBORG-MGXGXHCVSA-N |
| XLogP | 5.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|