C23H35NO4S — CID 58175116
2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate (PubChem CID 58175116) has the molecular formula C23H35NO4S and a molecular weight of 421.60 g/mol. Its IUPAC name is 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 58175116 |
| Molecular Formula | C23H35NO4S |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-ethylhexyl (2E,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CCCCC(CC)COC(=O)/C(=C\C=C\N(CC)CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H35NO4S/c1-5-9-14-20(6-2)19-28-23(25)22(17-13-18-24(7-3)8-4)29(26,27)21-15-11-10-12-16-21/h10-13,15-18,20H,5-9,14,19H2,1-4H3/b18-13+,22-17+ |
| InChIKey | OUOPCMURMJRIKH-JWRHMULSSA-N |
| XLogP | 4.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|