C17H23NO4S — CID 58911992
ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate (PubChem CID 58911992) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate.
| Compound Name | ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 58911992 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate |
| SMILES | CCOC(=O)C(=CC=CN(CC)CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4S/c1-4-18(5-2)14-10-13-16(17(19)22-6-3)23(20,21)15-11-8-7-9-12-15/h7-14H,4-6H2,1-3H3 |
| InChIKey | WWFPHONPCQANDG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|