C37H59NO8S — CID 159229810
octyl (2Z,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate;1,1,3,3-tetramethoxypropane;toluene (PubChem CID 159229810) has the molecular formula C37H59NO8S and a molecular weight of 677.95 g/mol. Its IUPAC name is octyl (2Z,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate;1,1,3,3-tetramethoxypropane;toluene.
| Compound Name | octyl (2Z,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate;1,1,3,3-tetramethoxypropane;toluene |
|---|---|
| PubChem CID | 159229810 |
| Molecular Formula | C37H59NO8S |
| Molecular Weight | 677.95 g/mol |
| Exact Mass | 677.40 |
| IUPAC Name | octyl (2Z,4E)-2-(benzenesulfonyl)-5-(diethylamino)penta-2,4-dienoate;1,1,3,3-tetramethoxypropane;toluene |
| SMILES | CCCCCCCCOC(=O)/C(=C/C=C/N(CC)CC)S(=O)(=O)c1ccccc1.COC(CC(OC)OC)OC.Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO4S.C7H16O4.C7H8/c1-4-7-8-9-10-14-20-28-23(25)22(18-15-19-24(5-2)6-3)29(26,27)21-16-12-11-13-17-21;1-8-6(9-2)5-7(10-3)11-4;1-7-5-3-2-4-6-7/h11-13,15-19H,4-10,14,20H2,1-3H3;6-7H,5H2,1-4H3;2-6H,1H3/b19-15+,22-18-;; |
| InChIKey | KSTGFZOWVNXOTH-TVNYSNRSSA-N |
| XLogP | 7.71 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.95 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|