C24H39NO4S — CID 139470248
octyl (E)-2-(benzenesulfonyl)-5-(diethylamino)-4-methylpent-2-enoate (PubChem CID 139470248) has the molecular formula C24H39NO4S and a molecular weight of 437.65 g/mol. Its IUPAC name is octyl (E)-2-(benzenesulfonyl)-5-(diethylamino)-4-methylpent-2-enoate.
| Compound Name | octyl (E)-2-(benzenesulfonyl)-5-(diethylamino)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 139470248 |
| Molecular Formula | C24H39NO4S |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | octyl (E)-2-(benzenesulfonyl)-5-(diethylamino)-4-methylpent-2-enoate |
| SMILES | CCCCCCCCOC(=O)/C(=C\C(C)CN(CC)CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H39NO4S/c1-5-8-9-10-11-15-18-29-24(26)23(19-21(4)20-25(6-2)7-3)30(27,28)22-16-13-12-14-17-22/h12-14,16-17,19,21H,5-11,15,18,20H2,1-4H3/b23-19+ |
| InChIKey | STYBIZJZIZILCP-FCDQGJHFSA-N |
| XLogP | 5.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|