C43H62N2O6S — CID 59971621
octyl (2E,4E)-2-(benzenesulfonyl)-5-[4-[(1Z,3E)-4-benzyl-5-octylperoxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate (PubChem CID 59971621) has the molecular formula C43H62N2O6S and a molecular weight of 735.04 g/mol. Its IUPAC name is octyl (2E,4E)-2-(benzenesulfonyl)-5-[4-[(1Z,3E)-4-benzyl-5-octylperoxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate.
| Compound Name | octyl (2E,4E)-2-(benzenesulfonyl)-5-[4-[(1Z,3E)-4-benzyl-5-octylperoxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 59971621 |
| Molecular Formula | C43H62N2O6S |
| Molecular Weight | 735.04 g/mol |
| Exact Mass | 734.43 |
| IUPAC Name | octyl (2E,4E)-2-(benzenesulfonyl)-5-[4-[(1Z,3E)-4-benzyl-5-octylperoxypenta-1,3-dienyl]piperazin-1-yl]penta-2,4-dienoate |
| SMILES | CCCCCCCCOOC/C(=C/C=C\N1CCN(/C=C/C=C(\C(=O)OCCCCCCCC)S(=O)(=O)c2ccccc2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C43H62N2O6S/c1-3-5-7-9-11-19-35-49-43(46)42(52(47,48)41-26-17-14-18-27-41)28-22-30-45-33-31-44(32-34-45)29-21-25-40(37-39-23-15-13-16-24-39)38-51-50-36-20-12-10-8-6-4-2/h13-18,21-30H,3-12,19-20,31-38H2,1-2H3/b29-21-,30-22+,40-25+,42-28+ |
| InChIKey | XWTHPNIWTFXOJG-ZZYRJSHXSA-N |
| XLogP | 9.37 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.04 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|