C30H31NO4S — CID 76653749
heptyl 2-(benzenesulfonyl)-5-carbazol-9-ylpenta-2,4-dienoate (PubChem CID 76653749) has the molecular formula C30H31NO4S and a molecular weight of 501.65 g/mol. Its IUPAC name is heptyl 2-(benzenesulfonyl)-5-carbazol-9-ylpenta-2,4-dienoate.
| Compound Name | heptyl 2-(benzenesulfonyl)-5-carbazol-9-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 76653749 |
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | heptyl 2-(benzenesulfonyl)-5-carbazol-9-ylpenta-2,4-dienoate |
| SMILES | CCCCCCCOC(=O)C(=CC=Cn1c2ccccc2c2ccccc21)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31NO4S/c1-2-3-4-5-13-23-35-30(32)29(36(33,34)24-15-7-6-8-16-24)21-14-22-31-27-19-11-9-17-25(27)26-18-10-12-20-28(26)31/h6-12,14-22H,2-5,13,23H2,1H3 |
| InChIKey | KHFXNYTUNNWBLM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|