C18H26O6S — CID 11760430
methyl (E,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)non-2-enoate (PubChem CID 11760430) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl (E,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)non-2-enoate.
| Compound Name | methyl (E,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)non-2-enoate |
|---|---|
| PubChem CID | 11760430 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl (E,4S)-2-(benzenesulfonyl)-4-(methoxymethoxy)non-2-enoate |
| SMILES | CCCCC[C@@H](/C=C(\C(=O)OC)S(=O)(=O)c1ccccc1)OCOC |
| InChI | InChI=1S/C18H26O6S/c1-4-5-7-10-15(24-14-22-2)13-17(18(19)23-3)25(20,21)16-11-8-6-9-12-16/h6,8-9,11-13,15H,4-5,7,10,14H2,1-3H3/b17-13+/t15-/m0/s1 |
| InChIKey | ZZYWDEUNAGOCDZ-XOAFGZPJSA-N |
| XLogP | 3.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|