C21H31NO3S — CID 59767462
6-[ethyl(hexyl)amino]-3-(4-methylphenyl)sulfonylhexa-3,5-dien-2-one (PubChem CID 59767462) has the molecular formula C21H31NO3S and a molecular weight of 377.55 g/mol. Its IUPAC name is 6-[ethyl(hexyl)amino]-3-(4-methylphenyl)sulfonylhexa-3,5-dien-2-one.
| Compound Name | 6-[ethyl(hexyl)amino]-3-(4-methylphenyl)sulfonylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 59767462 |
| Molecular Formula | C21H31NO3S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6-[ethyl(hexyl)amino]-3-(4-methylphenyl)sulfonylhexa-3,5-dien-2-one |
| SMILES | CCCCCCN(C=CC=C(C(C)=O)S(=O)(=O)c1ccc(C)cc1)CC |
| InChI | InChI=1S/C21H31NO3S/c1-5-7-8-9-16-22(6-2)17-10-11-21(19(4)23)26(24,25)20-14-12-18(3)13-15-20/h10-15,17H,5-9,16H2,1-4H3 |
| InChIKey | BWKWRDTVFJOONU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|