C18H24HgO4 — CID 16684197
[(E)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-phenylmercury (PubChem CID 16684197) has the molecular formula C18H24HgO4 and a molecular weight of 504.98 g/mol. Its IUPAC name is [(E)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-phenylmercury.
| Compound Name | [(E)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-phenylmercury |
|---|---|
| PubChem CID | 16684197 |
| Molecular Formula | C18H24HgO4 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [(E)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-phenylmercury |
| SMILES | CCCCC(CC)COC(=O)/C=C/C(=O)O[Hg]c1ccccc1 |
| InChI | InChI=1S/C12H20O4.C6H5.Hg/c1-3-5-6-10(4-2)9-16-12(15)8-7-11(13)14;1-2-4-6-5-3-1;/h7-8,10H,3-6,9H2,1-2H3,(H,13,14);1-5H;/q;;+1/p-1/b8-7+;; |
| InChIKey | HSNHKPGAPVRKQV-MIIBGCIDSA-M |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|