C24H30O3 — CID 134837892
[(2R)-2-ethylhexyl] (E)-3-(2-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 134837892) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is [(2R)-2-ethylhexyl] (E)-3-(2-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-2-ethylhexyl] (E)-3-(2-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 134837892 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(2R)-2-ethylhexyl] (E)-3-(2-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | CCCC[C@@H](CC)COC(=O)/C=C/c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H30O3/c1-3-5-11-20(4-2)18-27-24(25)17-16-22-14-9-10-15-23(22)26-19-21-12-7-6-8-13-21/h6-10,12-17,20H,3-5,11,18-19H2,1-2H3/b17-16+/t20-/m1/s1 |
| InChIKey | TVRVWMZTCYAPEE-KBZZJAQTSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|