C20H30O5 — CID 91148394
2-ethylhexyl 3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 91148394) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-ethylhexyl 3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-ethylhexyl 3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91148394 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-ethylhexyl 3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C20H30O5/c1-6-8-9-15(7-2)14-25-20(21)11-10-16-12-18(23-4)19(24-5)13-17(16)22-3/h10-13,15H,6-9,14H2,1-5H3 |
| InChIKey | XFMQYWFVMBRSGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|