C18H24Cl2O3 — CID 162345640
2-ethylhexyl (E)-3-(2,6-dichloro-4-methoxyphenyl)prop-2-enoate (PubChem CID 162345640) has the molecular formula C18H24Cl2O3 and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-(2,6-dichloro-4-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-(2,6-dichloro-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162345640 |
| Molecular Formula | C18H24Cl2O3 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-ethylhexyl (E)-3-(2,6-dichloro-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1c(Cl)cc(OC)cc1Cl |
| InChI | InChI=1S/C18H24Cl2O3/c1-4-6-7-13(5-2)12-23-18(21)9-8-15-16(19)10-14(22-3)11-17(15)20/h8-11,13H,4-7,12H2,1-3H3/b9-8+ |
| InChIKey | YJFVVSWNIGXSEA-CMDGGOBGSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|