C18H23ClO4 — CID 91701260
4-O-(2-chlorophenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate (PubChem CID 91701260) has the molecular formula C18H23ClO4 and a molecular weight of 338.83 g/mol. Its IUPAC name is 4-O-(2-chlorophenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(2-chlorophenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91701260 |
| Molecular Formula | C18H23ClO4 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-O-(2-chlorophenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate |
| SMILES | CCCCC(CC)COC(=O)/C=C/C(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C18H23ClO4/c1-3-5-8-14(4-2)13-22-17(20)11-12-18(21)23-16-10-7-6-9-15(16)19/h6-7,9-12,14H,3-5,8,13H2,1-2H3/b12-11+ |
| InChIKey | OSCMBMNZFREGEI-VAWYXSNFSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|