C20H28O6 — CID 91721489
4-O-(2,6-dimethoxyphenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate (PubChem CID 91721489) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-O-(2,6-dimethoxyphenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(2,6-dimethoxyphenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91721489 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-O-(2,6-dimethoxyphenyl) 1-O-(2-ethylhexyl) (E)-but-2-enedioate |
| SMILES | CCCCC(CC)COC(=O)/C=C/C(=O)Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C20H28O6/c1-5-7-9-15(6-2)14-25-18(21)12-13-19(22)26-20-16(23-3)10-8-11-17(20)24-4/h8,10-13,15H,5-7,9,14H2,1-4H3/b13-12+ |
| InChIKey | SVCXTDDDLHQROL-OUKQBFOZSA-N |
| XLogP | 3.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|